C25H22ClNO4S — CID 11225131
1-benzyl-3-(4-chlorophenyl)-5-(4-methylphenyl)sulfonylpiperidine-2,6-dione (PubChem CID 11225131) has the molecular formula C25H22ClNO4S and a molecular weight of 467.97 g/mol. Its IUPAC name is 1-benzyl-3-(4-chlorophenyl)-5-(4-methylphenyl)sulfonylpiperidine-2,6-dione.
| Compound Name | 1-benzyl-3-(4-chlorophenyl)-5-(4-methylphenyl)sulfonylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 11225131 |
| Molecular Formula | C25H22ClNO4S |
| Molecular Weight | 467.97 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | 1-benzyl-3-(4-chlorophenyl)-5-(4-methylphenyl)sulfonylpiperidine-2,6-dione |
| SMILES | Cc1ccc(S(=O)(=O)C2CC(c3ccc(Cl)cc3)C(=O)N(Cc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C25H22ClNO4S/c1-17-7-13-21(14-8-17)32(30,31)23-15-22(19-9-11-20(26)12-10-19)24(28)27(25(23)29)16-18-5-3-2-4-6-18/h2-14,22-23H,15-16H2,1H3 |
| InChIKey | OXFZKEBVIGTMHA-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.97 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|