C22H20N2O5S — CID 177437471
N-[[(3aR,6aR)-2-benzyl-1,3,4-trioxo-3a,6a-dihydrocyclopenta[c]pyrrol-5-yl]methyl]-4-methylbenzenesulfonamide (PubChem CID 177437471) has the molecular formula C22H20N2O5S and a molecular weight of 424.48 g/mol. Its IUPAC name is N-[[(3aR,6aR)-2-benzyl-1,3,4-trioxo-3a,6a-dihydrocyclopenta[c]pyrrol-5-yl]methyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[[(3aR,6aR)-2-benzyl-1,3,4-trioxo-3a,6a-dihydrocyclopenta[c]pyrrol-5-yl]methyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 177437471 |
| Molecular Formula | C22H20N2O5S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | N-[[(3aR,6aR)-2-benzyl-1,3,4-trioxo-3a,6a-dihydrocyclopenta[c]pyrrol-5-yl]methyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC2=C[C@H]3C(=O)N(Cc4ccccc4)C(=O)[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C22H20N2O5S/c1-14-7-9-17(10-8-14)30(28,29)23-12-16-11-18-19(20(16)25)22(27)24(21(18)26)13-15-5-3-2-4-6-15/h2-11,18-19,23H,12-13H2,1H3/t18-,19-/m1/s1 |
| InChIKey | LTOFDCBAHKAVQZ-RTBURBONSA-N |
| XLogP | 1.58 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|