C20H22N2O4S — CID 164686970
N-[3-(3-benzyl-2-oxo-1,3-oxazol-5-yl)propyl]-4-methylbenzenesulfonamide (PubChem CID 164686970) has the molecular formula C20H22N2O4S and a molecular weight of 386.47 g/mol. Its IUPAC name is N-[3-(3-benzyl-2-oxo-1,3-oxazol-5-yl)propyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[3-(3-benzyl-2-oxo-1,3-oxazol-5-yl)propyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 164686970 |
| Molecular Formula | C20H22N2O4S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | N-[3-(3-benzyl-2-oxo-1,3-oxazol-5-yl)propyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCCc2cn(Cc3ccccc3)c(=O)o2)cc1 |
| InChI | InChI=1S/C20H22N2O4S/c1-16-9-11-19(12-10-16)27(24,25)21-13-5-8-18-15-22(20(23)26-18)14-17-6-3-2-4-7-17/h2-4,6-7,9-12,15,21H,5,8,13-14H2,1H3 |
| InChIKey | WHGJXPPMIBUKOP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|