C23H25NO2S — CID 101038565
N-[3-(3-benzylphenyl)propyl]-4-methylbenzenesulfonamide (PubChem CID 101038565) has the molecular formula C23H25NO2S and a molecular weight of 379.53 g/mol. Its IUPAC name is N-[3-(3-benzylphenyl)propyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[3-(3-benzylphenyl)propyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 101038565 |
| Molecular Formula | C23H25NO2S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | N-[3-(3-benzylphenyl)propyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCCc2cccc(Cc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C23H25NO2S/c1-19-12-14-23(15-13-19)27(25,26)24-16-6-11-21-9-5-10-22(18-21)17-20-7-3-2-4-8-20/h2-5,7-10,12-15,18,24H,6,11,16-17H2,1H3 |
| InChIKey | POPRVECUGAXVMO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|