C20H22N2O3S — CID 110414948
4-(2,5-dimethyl-1,3-oxazol-4-yl)-N-(3-phenylpropyl)benzenesulfonamide (PubChem CID 110414948) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is 4-(2,5-dimethyl-1,3-oxazol-4-yl)-N-(3-phenylpropyl)benzenesulfonamide.
| Compound Name | 4-(2,5-dimethyl-1,3-oxazol-4-yl)-N-(3-phenylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 110414948 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 4-(2,5-dimethyl-1,3-oxazol-4-yl)-N-(3-phenylpropyl)benzenesulfonamide |
| SMILES | Cc1nc(-c2ccc(S(=O)(=O)NCCCc3ccccc3)cc2)c(C)o1 |
| InChI | InChI=1S/C20H22N2O3S/c1-15-20(22-16(2)25-15)18-10-12-19(13-11-18)26(23,24)21-14-6-9-17-7-4-3-5-8-17/h3-5,7-8,10-13,21H,6,9,14H2,1-2H3 |
| InChIKey | BOCFNAQMXDNKJJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|