C12H14N2O4S — CID 110611820
4-(2,5-dimethyl-1,3-oxazol-4-yl)-N-methoxybenzenesulfonamide (PubChem CID 110611820) has the molecular formula C12H14N2O4S and a molecular weight of 282.32 g/mol. Its IUPAC name is 4-(2,5-dimethyl-1,3-oxazol-4-yl)-N-methoxybenzenesulfonamide.
| Compound Name | 4-(2,5-dimethyl-1,3-oxazol-4-yl)-N-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 110611820 |
| Molecular Formula | C12H14N2O4S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 4-(2,5-dimethyl-1,3-oxazol-4-yl)-N-methoxybenzenesulfonamide |
| SMILES | CONS(=O)(=O)c1ccc(-c2nc(C)oc2C)cc1 |
| InChI | InChI=1S/C12H14N2O4S/c1-8-12(13-9(2)18-8)10-4-6-11(7-5-10)19(15,16)14-17-3/h4-7,14H,1-3H3 |
| InChIKey | YOFGNRQWVQAMME-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|