C23H25NO4S2 — CID 57430153
5-(benzenesulfonyl)-2-ethyl-N-(3-phenylpropyl)benzenesulfonamide (PubChem CID 57430153) has the molecular formula C23H25NO4S2 and a molecular weight of 443.59 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-2-ethyl-N-(3-phenylpropyl)benzenesulfonamide.
| Compound Name | 5-(benzenesulfonyl)-2-ethyl-N-(3-phenylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 57430153 |
| Molecular Formula | C23H25NO4S2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 5-(benzenesulfonyl)-2-ethyl-N-(3-phenylpropyl)benzenesulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)c2ccccc2)cc1S(=O)(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C23H25NO4S2/c1-2-20-15-16-22(29(25,26)21-13-7-4-8-14-21)18-23(20)30(27,28)24-17-9-12-19-10-5-3-6-11-19/h3-8,10-11,13-16,18,24H,2,9,12,17H2,1H3 |
| InChIKey | AYGFXSCUXGSIQW-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|