C22H24N2O6S3 — CID 57430146
5-(benzenesulfonyl)-2-ethyl-N-[2-(4-sulfamoylphenyl)ethyl]benzenesulfonamide (PubChem CID 57430146) has the molecular formula C22H24N2O6S3 and a molecular weight of 508.64 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-2-ethyl-N-[2-(4-sulfamoylphenyl)ethyl]benzenesulfonamide.
| Compound Name | 5-(benzenesulfonyl)-2-ethyl-N-[2-(4-sulfamoylphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 57430146 |
| Molecular Formula | C22H24N2O6S3 |
| Molecular Weight | 508.64 g/mol |
| Exact Mass | 508.08 |
| IUPAC Name | 5-(benzenesulfonyl)-2-ethyl-N-[2-(4-sulfamoylphenyl)ethyl]benzenesulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)c2ccccc2)cc1S(=O)(=O)NCCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C22H24N2O6S3/c1-2-18-10-13-21(31(25,26)19-6-4-3-5-7-19)16-22(18)33(29,30)24-15-14-17-8-11-20(12-9-17)32(23,27)28/h3-13,16,24H,2,14-15H2,1H3,(H2,23,27,28) |
| InChIKey | MVRUUPJWDVIXLX-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 140.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.64 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |