C19H22N4O4S2 — CID 42283119
1-benzyl-3-methyl-N-[2-(4-sulfamoylphenyl)ethyl]pyrazole-4-sulfonamide (PubChem CID 42283119) has the molecular formula C19H22N4O4S2 and a molecular weight of 434.54 g/mol. Its IUPAC name is 1-benzyl-3-methyl-N-[2-(4-sulfamoylphenyl)ethyl]pyrazole-4-sulfonamide.
| Compound Name | 1-benzyl-3-methyl-N-[2-(4-sulfamoylphenyl)ethyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42283119 |
| Molecular Formula | C19H22N4O4S2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 1-benzyl-3-methyl-N-[2-(4-sulfamoylphenyl)ethyl]pyrazole-4-sulfonamide |
| SMILES | Cc1nn(Cc2ccccc2)cc1S(=O)(=O)NCCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C19H22N4O4S2/c1-15-19(14-23(22-15)13-17-5-3-2-4-6-17)29(26,27)21-12-11-16-7-9-18(10-8-16)28(20,24)25/h2-10,14,21H,11-13H2,1H3,(H2,20,24,25) |
| InChIKey | XFJHKPSIDBGALR-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 124.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |