C17H14F3N3O2S — CID 42283111
1-benzyl-3-methyl-N-(2,3,4-trifluorophenyl)pyrazole-4-sulfonamide (PubChem CID 42283111) has the molecular formula C17H14F3N3O2S and a molecular weight of 381.38 g/mol. Its IUPAC name is 1-benzyl-3-methyl-N-(2,3,4-trifluorophenyl)pyrazole-4-sulfonamide.
| Compound Name | 1-benzyl-3-methyl-N-(2,3,4-trifluorophenyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42283111 |
| Molecular Formula | C17H14F3N3O2S |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 1-benzyl-3-methyl-N-(2,3,4-trifluorophenyl)pyrazole-4-sulfonamide |
| SMILES | Cc1nn(Cc2ccccc2)cc1S(=O)(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H14F3N3O2S/c1-11-15(10-23(21-11)9-12-5-3-2-4-6-12)26(24,25)22-14-8-7-13(18)16(19)17(14)20/h2-8,10,22H,9H2,1H3 |
| InChIKey | MAOWABJXUVFKMI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|