C19H18F3N3O2S — CID 42344987
3-tert-butyl-1-phenyl-N-(2,3,4-trifluorophenyl)pyrazole-4-sulfonamide (PubChem CID 42344987) has the molecular formula C19H18F3N3O2S and a molecular weight of 409.43 g/mol. Its IUPAC name is 3-tert-butyl-1-phenyl-N-(2,3,4-trifluorophenyl)pyrazole-4-sulfonamide.
| Compound Name | 3-tert-butyl-1-phenyl-N-(2,3,4-trifluorophenyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42344987 |
| Molecular Formula | C19H18F3N3O2S |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 3-tert-butyl-1-phenyl-N-(2,3,4-trifluorophenyl)pyrazole-4-sulfonamide |
| SMILES | CC(C)(C)c1nn(-c2ccccc2)cc1S(=O)(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C19H18F3N3O2S/c1-19(2,3)18-15(11-25(23-18)12-7-5-4-6-8-12)28(26,27)24-14-10-9-13(20)16(21)17(14)22/h4-11,24H,1-3H3 |
| InChIKey | MJWADRFAVZUYNR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|