C23H24N4O2S — CID 42284784
3-tert-butyl-N-(2-methylquinolin-4-yl)-1-phenylpyrazole-4-sulfonamide (PubChem CID 42284784) has the molecular formula C23H24N4O2S and a molecular weight of 420.54 g/mol. Its IUPAC name is 3-tert-butyl-N-(2-methylquinolin-4-yl)-1-phenylpyrazole-4-sulfonamide.
| Compound Name | 3-tert-butyl-N-(2-methylquinolin-4-yl)-1-phenylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42284784 |
| Molecular Formula | C23H24N4O2S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 3-tert-butyl-N-(2-methylquinolin-4-yl)-1-phenylpyrazole-4-sulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2cn(-c3ccccc3)nc2C(C)(C)C)c2ccccc2n1 |
| InChI | InChI=1S/C23H24N4O2S/c1-16-14-20(18-12-8-9-13-19(18)24-16)26-30(28,29)21-15-27(17-10-6-5-7-11-17)25-22(21)23(2,3)4/h5-15H,1-4H3,(H,24,26) |
| InChIKey | KCSRGYDOYUINFF-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |