C20H22BrN3O2S — CID 42284781
N-(4-bromo-2-methylphenyl)-3-tert-butyl-1-phenylpyrazole-4-sulfonamide (PubChem CID 42284781) has the molecular formula C20H22BrN3O2S and a molecular weight of 448.39 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-3-tert-butyl-1-phenylpyrazole-4-sulfonamide.
| Compound Name | N-(4-bromo-2-methylphenyl)-3-tert-butyl-1-phenylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42284781 |
| Molecular Formula | C20H22BrN3O2S |
| Molecular Weight | 448.39 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-3-tert-butyl-1-phenylpyrazole-4-sulfonamide |
| SMILES | Cc1cc(Br)ccc1NS(=O)(=O)c1cn(-c2ccccc2)nc1C(C)(C)C |
| InChI | InChI=1S/C20H22BrN3O2S/c1-14-12-15(21)10-11-17(14)23-27(25,26)18-13-24(16-8-6-5-7-9-16)22-19(18)20(2,3)4/h5-13,23H,1-4H3 |
| InChIKey | LQLZIOWUWCQHTF-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.39 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |