C16H12ClF2N3O2S — CID 22207182
N-(1-benzyl-4-chloropyrazol-3-yl)-2,4-difluorobenzenesulfonamide (PubChem CID 22207182) has the molecular formula C16H12ClF2N3O2S and a molecular weight of 383.81 g/mol. Its IUPAC name is N-(1-benzyl-4-chloropyrazol-3-yl)-2,4-difluorobenzenesulfonamide.
| Compound Name | N-(1-benzyl-4-chloropyrazol-3-yl)-2,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 22207182 |
| Molecular Formula | C16H12ClF2N3O2S |
| Molecular Weight | 383.81 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | N-(1-benzyl-4-chloropyrazol-3-yl)-2,4-difluorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1nn(Cc2ccccc2)cc1Cl)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H12ClF2N3O2S/c17-13-10-22(9-11-4-2-1-3-5-11)20-16(13)21-25(23,24)15-7-6-12(18)8-14(15)19/h1-8,10H,9H2,(H,20,21) |
| InChIKey | HGTYAYCYUYEOLF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.81 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |