C17H15ClFN3O2S — CID 39853499
N-[4-chloro-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-1-phenylmethanesulfonamide (PubChem CID 39853499) has the molecular formula C17H15ClFN3O2S and a molecular weight of 379.84 g/mol. Its IUPAC name is N-[4-chloro-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-1-phenylmethanesulfonamide.
| Compound Name | N-[4-chloro-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-1-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 39853499 |
| Molecular Formula | C17H15ClFN3O2S |
| Molecular Weight | 379.84 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | N-[4-chloro-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-1-phenylmethanesulfonamide |
| SMILES | O=S(=O)(Cc1ccccc1)Nc1nn(Cc2ccccc2F)cc1Cl |
| InChI | InChI=1S/C17H15ClFN3O2S/c18-15-11-22(10-14-8-4-5-9-16(14)19)20-17(15)21-25(23,24)12-13-6-2-1-3-7-13/h1-9,11H,10,12H2,(H,20,21) |
| InChIKey | JHQPNIBZPYUGEI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.84 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |