C22H23NO6S2 — CID 25180257
5-(benzenesulfonyl)-2-methoxy-N-[2-(3-methoxyphenyl)ethyl]benzenesulfonamide (PubChem CID 25180257) has the molecular formula C22H23NO6S2 and a molecular weight of 461.56 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-2-methoxy-N-[2-(3-methoxyphenyl)ethyl]benzenesulfonamide.
| Compound Name | 5-(benzenesulfonyl)-2-methoxy-N-[2-(3-methoxyphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 25180257 |
| Molecular Formula | C22H23NO6S2 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | 5-(benzenesulfonyl)-2-methoxy-N-[2-(3-methoxyphenyl)ethyl]benzenesulfonamide |
| SMILES | COc1cccc(CCNS(=O)(=O)c2cc(S(=O)(=O)c3ccccc3)ccc2OC)c1 |
| InChI | InChI=1S/C22H23NO6S2/c1-28-18-8-6-7-17(15-18)13-14-23-31(26,27)22-16-20(11-12-21(22)29-2)30(24,25)19-9-4-3-5-10-19/h3-12,15-16,23H,13-14H2,1-2H3 |
| InChIKey | JSHRYBFEGGJBSW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |