C21H20FNO5S2 — CID 57430151
5-(benzenesulfonyl)-N-[2-(3-fluorophenyl)ethyl]-2-methoxybenzenesulfonamide (PubChem CID 57430151) has the molecular formula C21H20FNO5S2 and a molecular weight of 449.53 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-N-[2-(3-fluorophenyl)ethyl]-2-methoxybenzenesulfonamide.
| Compound Name | 5-(benzenesulfonyl)-N-[2-(3-fluorophenyl)ethyl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 57430151 |
| Molecular Formula | C21H20FNO5S2 |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | 5-(benzenesulfonyl)-N-[2-(3-fluorophenyl)ethyl]-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)c2ccccc2)cc1S(=O)(=O)NCCc1cccc(F)c1 |
| InChI | InChI=1S/C21H20FNO5S2/c1-28-20-11-10-19(29(24,25)18-8-3-2-4-9-18)15-21(20)30(26,27)23-13-12-16-6-5-7-17(22)14-16/h2-11,14-15,23H,12-13H2,1H3 |
| InChIKey | MSOBGBIMPJBERS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |