C28H26FNO4S — CID 6737244
N-[2-[3,4-bis(phenylmethoxy)phenyl]ethyl]-3-fluorobenzenesulfonamide (PubChem CID 6737244) has the molecular formula C28H26FNO4S and a molecular weight of 491.58 g/mol. Its IUPAC name is N-[2-[3,4-bis(phenylmethoxy)phenyl]ethyl]-3-fluorobenzenesulfonamide.
| Compound Name | N-[2-[3,4-bis(phenylmethoxy)phenyl]ethyl]-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 6737244 |
| Molecular Formula | C28H26FNO4S |
| Molecular Weight | 491.58 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | N-[2-[3,4-bis(phenylmethoxy)phenyl]ethyl]-3-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCCc1ccc(OCc2ccccc2)c(OCc2ccccc2)c1)c1cccc(F)c1 |
| InChI | InChI=1S/C28H26FNO4S/c29-25-12-7-13-26(19-25)35(31,32)30-17-16-22-14-15-27(33-20-23-8-3-1-4-9-23)28(18-22)34-21-24-10-5-2-6-11-24/h1-15,18-19,30H,16-17,20-21H2 |
| InChIKey | RPQPEJQITFJELN-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.58 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |