C21H19F2NO4S2 — CID 11979226
N-[2-(3-fluorophenyl)ethyl]-5-(4-fluorophenyl)sulfonyl-2-methylbenzenesulfonamide (PubChem CID 11979226) has the molecular formula C21H19F2NO4S2 and a molecular weight of 451.52 g/mol. Its IUPAC name is N-[2-(3-fluorophenyl)ethyl]-5-(4-fluorophenyl)sulfonyl-2-methylbenzenesulfonamide.
| Compound Name | N-[2-(3-fluorophenyl)ethyl]-5-(4-fluorophenyl)sulfonyl-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 11979226 |
| Molecular Formula | C21H19F2NO4S2 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | N-[2-(3-fluorophenyl)ethyl]-5-(4-fluorophenyl)sulfonyl-2-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc(F)cc2)cc1S(=O)(=O)NCCc1cccc(F)c1 |
| InChI | InChI=1S/C21H19F2NO4S2/c1-15-5-8-20(29(25,26)19-9-6-17(22)7-10-19)14-21(15)30(27,28)24-12-11-16-3-2-4-18(23)13-16/h2-10,13-14,24H,11-12H2,1H3 |
| InChIKey | FGTJYHOWFQWYFM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |