C20H17Cl2NO4S2 — CID 11978291
3-(benzenesulfonyl)-N-[2-(3,4-dichlorophenyl)ethyl]benzenesulfonamide (PubChem CID 11978291) has the molecular formula C20H17Cl2NO4S2 and a molecular weight of 470.40 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-N-[2-(3,4-dichlorophenyl)ethyl]benzenesulfonamide.
| Compound Name | 3-(benzenesulfonyl)-N-[2-(3,4-dichlorophenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 11978291 |
| Molecular Formula | C20H17Cl2NO4S2 |
| Molecular Weight | 470.40 g/mol |
| Exact Mass | 469.00 |
| IUPAC Name | 3-(benzenesulfonyl)-N-[2-(3,4-dichlorophenyl)ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCc1ccc(Cl)c(Cl)c1)c1cccc(S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C20H17Cl2NO4S2/c21-19-10-9-15(13-20(19)22)11-12-23-29(26,27)18-8-4-7-17(14-18)28(24,25)16-5-2-1-3-6-16/h1-10,13-14,23H,11-12H2 |
| InChIKey | BJONKTLGPQLOAQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |