C18H25N2O3PS2 — CID 11582338
N-[3-[(benzylamino)-methylphosphinothioyl]oxypropyl]-4-methylbenzenesulfonamide (PubChem CID 11582338) has the molecular formula C18H25N2O3PS2 and a molecular weight of 412.52 g/mol. Its IUPAC name is N-[3-[(benzylamino)-methylphosphinothioyl]oxypropyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[3-[(benzylamino)-methylphosphinothioyl]oxypropyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 11582338 |
| Molecular Formula | C18H25N2O3PS2 |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | N-[3-[(benzylamino)-methylphosphinothioyl]oxypropyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCCOP(C)(=S)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C18H25N2O3PS2/c1-16-9-11-18(12-10-16)26(21,22)20-13-6-14-23-24(2,25)19-15-17-7-4-3-5-8-17/h3-5,7-12,20H,6,13-15H2,1-2H3,(H,19,25) |
| InChIKey | DSFOUMIACQFCSU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|