C17H23N2O3PS2 — CID 11258036
N-[2-[(benzylamino)-methylphosphinothioyl]oxyethyl]-4-methylbenzenesulfonamide (PubChem CID 11258036) has the molecular formula C17H23N2O3PS2 and a molecular weight of 398.49 g/mol. Its IUPAC name is N-[2-[(benzylamino)-methylphosphinothioyl]oxyethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-[(benzylamino)-methylphosphinothioyl]oxyethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 11258036 |
| Molecular Formula | C17H23N2O3PS2 |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | N-[2-[(benzylamino)-methylphosphinothioyl]oxyethyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCOP(C)(=S)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C17H23N2O3PS2/c1-15-8-10-17(11-9-15)25(20,21)19-12-13-22-23(2,24)18-14-16-6-4-3-5-7-16/h3-11,19H,12-14H2,1-2H3,(H,18,24) |
| InChIKey | FNFKCPZMAZOCTQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|