C9H14N2O5S2 — CID 101414812
2-[(4-methylphenyl)sulfonylamino]ethyl sulfamate (PubChem CID 101414812) has the molecular formula C9H14N2O5S2 and a molecular weight of 294.35 g/mol. Its IUPAC name is 2-[(4-methylphenyl)sulfonylamino]ethyl sulfamate.
| Compound Name | 2-[(4-methylphenyl)sulfonylamino]ethyl sulfamate |
|---|---|
| PubChem CID | 101414812 |
| Molecular Formula | C9H14N2O5S2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 2-[(4-methylphenyl)sulfonylamino]ethyl sulfamate |
| SMILES | Cc1ccc(S(=O)(=O)NCCOS(N)(=O)=O)cc1 |
| InChI | InChI=1S/C9H14N2O5S2/c1-8-2-4-9(5-3-8)17(12,13)11-6-7-16-18(10,14)15/h2-5,11H,6-7H2,1H3,(H2,10,14,15) |
| InChIKey | YEMNHANYJBMZBR-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|