C38H34N4O4 — CID 3922692
4,11-dibenzyl-7,14-bis(4-methylphenyl)-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone (PubChem CID 3922692) has the molecular formula C38H34N4O4 and a molecular weight of 610.71 g/mol. Its IUPAC name is 4,11-dibenzyl-7,14-bis(4-methylphenyl)-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone.
| Compound Name | 4,11-dibenzyl-7,14-bis(4-methylphenyl)-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone |
|---|---|
| PubChem CID | 3922692 |
| Molecular Formula | C38H34N4O4 |
| Molecular Weight | 610.71 g/mol |
| Exact Mass | 610.26 |
| IUPAC Name | 4,11-dibenzyl-7,14-bis(4-methylphenyl)-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone |
| SMILES | Cc1ccc(C2C3C(=O)N(Cc4ccccc4)C(=O)C3N3C(c4ccc(C)cc4)C4C(=O)N(Cc5ccccc5)C(=O)C4N23)cc1 |
| InChI | InChI=1S/C38H34N4O4/c1-23-13-17-27(18-14-23)31-29-33(37(45)39(35(29)43)21-25-9-5-3-6-10-25)42-32(28-19-15-24(2)16-20-28)30-34(41(31)42)38(46)40(36(30)44)22-26-11-7-4-8-12-26/h3-20,29-34H,21-22H2,1-2H3 |
| InChIKey | BNLKRYCUXBCYRU-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.71 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|