C18H16F3N3O4S — CID 2216971
N-[(4S)-1-benzyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-4-methylbenzenesulfonamide (PubChem CID 2216971) has the molecular formula C18H16F3N3O4S and a molecular weight of 427.40 g/mol. Its IUPAC name is N-[(4S)-1-benzyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(4S)-1-benzyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 2216971 |
| Molecular Formula | C18H16F3N3O4S |
| Molecular Weight | 427.40 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | N-[(4S)-1-benzyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@]2(C(F)(F)F)NC(=O)N(Cc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C18H16F3N3O4S/c1-12-7-9-14(10-8-12)29(27,28)23-17(18(19,20)21)15(25)24(16(26)22-17)11-13-5-3-2-4-6-13/h2-10,23H,11H2,1H3,(H,22,26)/t17-/m0/s1 |
| InChIKey | VXDXGJRCLPFYGG-KRWDZBQOSA-N |
| XLogP | 2.28 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.40 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|