C16H10ClF4N3O4S — CID 3995576
4-chloro-N-[1-(2-fluorophenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzenesulfonamide (PubChem CID 3995576) has the molecular formula C16H10ClF4N3O4S and a molecular weight of 451.79 g/mol. Its IUPAC name is 4-chloro-N-[1-(2-fluorophenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[1-(2-fluorophenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 3995576 |
| Molecular Formula | C16H10ClF4N3O4S |
| Molecular Weight | 451.79 g/mol |
| Exact Mass | 451.00 |
| IUPAC Name | 4-chloro-N-[1-(2-fluorophenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzenesulfonamide |
| SMILES | O=C1NC(NS(=O)(=O)c2ccc(Cl)cc2)(C(F)(F)F)C(=O)N1c1ccccc1F |
| InChI | InChI=1S/C16H10ClF4N3O4S/c17-9-5-7-10(8-6-9)29(27,28)23-15(16(19,20)21)13(25)24(14(26)22-15)12-4-2-1-3-11(12)18/h1-8,23H,(H,22,26) |
| InChIKey | OEYRFUAXTIFXIJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.79 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|