C18H17F3N4O4S — CID 16764162
4-amino-N-[1-(3,4-dimethylphenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzenesulfonamide (PubChem CID 16764162) has the molecular formula C18H17F3N4O4S and a molecular weight of 442.42 g/mol. Its IUPAC name is 4-amino-N-[1-(3,4-dimethylphenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzenesulfonamide.
| Compound Name | 4-amino-N-[1-(3,4-dimethylphenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 16764162 |
| Molecular Formula | C18H17F3N4O4S |
| Molecular Weight | 442.42 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 4-amino-N-[1-(3,4-dimethylphenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzenesulfonamide |
| SMILES | Cc1ccc(N2C(=O)NC(NS(=O)(=O)c3ccc(N)cc3)(C(F)(F)F)C2=O)cc1C |
| InChI | InChI=1S/C18H17F3N4O4S/c1-10-3-6-13(9-11(10)2)25-15(26)17(18(19,20)21,23-16(25)27)24-30(28,29)14-7-4-12(22)5-8-14/h3-9,24H,22H2,1-2H3,(H,23,27) |
| InChIKey | OSRKDZUPSKNFSP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|