C19H18F3N3O4S — CID 2962093
N-[2,5-dioxo-1-(2-phenylethyl)-4-(trifluoromethyl)imidazolidin-4-yl]-4-methylbenzenesulfonamide (PubChem CID 2962093) has the molecular formula C19H18F3N3O4S and a molecular weight of 441.43 g/mol. Its IUPAC name is N-[2,5-dioxo-1-(2-phenylethyl)-4-(trifluoromethyl)imidazolidin-4-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2,5-dioxo-1-(2-phenylethyl)-4-(trifluoromethyl)imidazolidin-4-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 2962093 |
| Molecular Formula | C19H18F3N3O4S |
| Molecular Weight | 441.43 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | N-[2,5-dioxo-1-(2-phenylethyl)-4-(trifluoromethyl)imidazolidin-4-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC2(C(F)(F)F)NC(=O)N(CCc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C19H18F3N3O4S/c1-13-7-9-15(10-8-13)30(28,29)24-18(19(20,21)22)16(26)25(17(27)23-18)12-11-14-5-3-2-4-6-14/h2-10,24H,11-12H2,1H3,(H,23,27) |
| InChIKey | LMTMJGGMEPSGSO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|