C17H13ClF3N3O4S — CID 46500675
N-[1-(4-chlorophenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-4-methylbenzenesulfonamide (PubChem CID 46500675) has the molecular formula C17H13ClF3N3O4S and a molecular weight of 447.82 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[1-(4-chlorophenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 46500675 |
| Molecular Formula | C17H13ClF3N3O4S |
| Molecular Weight | 447.82 g/mol |
| Exact Mass | 447.03 |
| IUPAC Name | N-[1-(4-chlorophenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC2(C(F)(F)F)NC(=O)N(c3ccc(Cl)cc3)C2=O)cc1 |
| InChI | InChI=1S/C17H13ClF3N3O4S/c1-10-2-8-13(9-3-10)29(27,28)23-16(17(19,20)21)14(25)24(15(26)22-16)12-6-4-11(18)5-7-12/h2-9,23H,1H3,(H,22,26) |
| InChIKey | NNZKNIRGFHXDQB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.82 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|