C13H13F3N4O5S — CID 2220238
N-[4-[[(4R)-1-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]sulfamoyl]phenyl]acetamide (PubChem CID 2220238) has the molecular formula C13H13F3N4O5S and a molecular weight of 394.33 g/mol. Its IUPAC name is N-[4-[[(4R)-1-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[[(4R)-1-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 2220238 |
| Molecular Formula | C13H13F3N4O5S |
| Molecular Weight | 394.33 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | N-[4-[[(4R)-1-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N[C@]2(C(F)(F)F)NC(=O)N(C)C2=O)cc1 |
| InChI | InChI=1S/C13H13F3N4O5S/c1-7(21)17-8-3-5-9(6-4-8)26(24,25)19-12(13(14,15)16)10(22)20(2)11(23)18-12/h3-6,19H,1-2H3,(H,17,21)(H,18,23)/t12-/m1/s1 |
| InChIKey | RAARLOIRHXNVNP-GFCCVEGCSA-N |
| XLogP | 0.36 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.33 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|