C14H17F3N4O4S — CID 2980031
4-amino-N-[1-butyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzenesulfonamide (PubChem CID 2980031) has the molecular formula C14H17F3N4O4S and a molecular weight of 394.38 g/mol. Its IUPAC name is 4-amino-N-[1-butyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzenesulfonamide.
| Compound Name | 4-amino-N-[1-butyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 2980031 |
| Molecular Formula | C14H17F3N4O4S |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 4-amino-N-[1-butyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzenesulfonamide |
| SMILES | CCCCN1C(=O)NC(NS(=O)(=O)c2ccc(N)cc2)(C(F)(F)F)C1=O |
| InChI | InChI=1S/C14H17F3N4O4S/c1-2-3-8-21-11(22)13(14(15,16)17,19-12(21)23)20-26(24,25)10-6-4-9(18)5-7-10/h4-7,20H,2-3,8,18H2,1H3,(H,19,23) |
| InChIKey | ZULJLFVSBORDCJ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|