C25H25NO4S — CID 101169796
1-benzyl-6-hydroxy-3-(4-methylphenyl)sulfonyl-4-phenylpiperidin-2-one (PubChem CID 101169796) has the molecular formula C25H25NO4S and a molecular weight of 435.55 g/mol. Its IUPAC name is 1-benzyl-6-hydroxy-3-(4-methylphenyl)sulfonyl-4-phenylpiperidin-2-one.
| Compound Name | 1-benzyl-6-hydroxy-3-(4-methylphenyl)sulfonyl-4-phenylpiperidin-2-one |
|---|---|
| PubChem CID | 101169796 |
| Molecular Formula | C25H25NO4S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 1-benzyl-6-hydroxy-3-(4-methylphenyl)sulfonyl-4-phenylpiperidin-2-one |
| SMILES | Cc1ccc(S(=O)(=O)C2C(=O)N(Cc3ccccc3)C(O)CC2c2ccccc2)cc1 |
| InChI | InChI=1S/C25H25NO4S/c1-18-12-14-21(15-13-18)31(29,30)24-22(20-10-6-3-7-11-20)16-23(27)26(25(24)28)17-19-8-4-2-5-9-19/h2-15,22-24,27H,16-17H2,1H3 |
| InChIKey | CQXKLJQMAAZIIH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |