C22H18FNO3S — CID 102439574
(3S,4S)-1-benzyl-3-(4-fluorophenyl)sulfonyl-4-phenylazetidin-2-one (PubChem CID 102439574) has the molecular formula C22H18FNO3S and a molecular weight of 395.46 g/mol. Its IUPAC name is (3S,4S)-1-benzyl-3-(4-fluorophenyl)sulfonyl-4-phenylazetidin-2-one.
| Compound Name | (3S,4S)-1-benzyl-3-(4-fluorophenyl)sulfonyl-4-phenylazetidin-2-one |
|---|---|
| PubChem CID | 102439574 |
| Molecular Formula | C22H18FNO3S |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | (3S,4S)-1-benzyl-3-(4-fluorophenyl)sulfonyl-4-phenylazetidin-2-one |
| SMILES | O=C1[C@@H](S(=O)(=O)c2ccc(F)cc2)[C@H](c2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C22H18FNO3S/c23-18-11-13-19(14-12-18)28(26,27)21-20(17-9-5-2-6-10-17)24(22(21)25)15-16-7-3-1-4-8-16/h1-14,20-21H,15H2/t20-,21-/m0/s1 |
| InChIKey | XZKKBDOHWQVODA-SFTDATJTSA-N |
| XLogP | 3.75 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |