C20H23NO3S — CID 11199116
(3S,4R)-3-(benzenesulfonyl)-1-tert-butyl-4-phenylpyrrolidin-2-one (PubChem CID 11199116) has the molecular formula C20H23NO3S and a molecular weight of 357.47 g/mol. Its IUPAC name is (3S,4R)-3-(benzenesulfonyl)-1-tert-butyl-4-phenylpyrrolidin-2-one.
| Compound Name | (3S,4R)-3-(benzenesulfonyl)-1-tert-butyl-4-phenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 11199116 |
| Molecular Formula | C20H23NO3S |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | (3S,4R)-3-(benzenesulfonyl)-1-tert-butyl-4-phenylpyrrolidin-2-one |
| SMILES | CC(C)(C)N1C[C@@H](c2ccccc2)[C@H](S(=O)(=O)c2ccccc2)C1=O |
| InChI | InChI=1S/C20H23NO3S/c1-20(2,3)21-14-17(15-10-6-4-7-11-15)18(19(21)22)25(23,24)16-12-8-5-9-13-16/h4-13,17-18H,14H2,1-3H3/t17-,18-/m0/s1 |
| InChIKey | ASLXVOIKDCOQDV-ROUUACIJSA-N |
| XLogP | 3.25 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |