C11H12O5S — CID 101269410
(2S,3R,4R)-2-(benzenesulfonyl)-3,4-dihydroxycyclopentan-1-one (PubChem CID 101269410) has the molecular formula C11H12O5S and a molecular weight of 256.28 g/mol. Its IUPAC name is (2S,3R,4R)-2-(benzenesulfonyl)-3,4-dihydroxycyclopentan-1-one.
| Compound Name | (2S,3R,4R)-2-(benzenesulfonyl)-3,4-dihydroxycyclopentan-1-one |
|---|---|
| PubChem CID | 101269410 |
| Molecular Formula | C11H12O5S |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | (2S,3R,4R)-2-(benzenesulfonyl)-3,4-dihydroxycyclopentan-1-one |
| SMILES | O=C1C[C@@H](O)[C@@H](O)[C@@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H12O5S/c12-8-6-9(13)11(10(8)14)17(15,16)7-4-2-1-3-5-7/h1-5,8,10-12,14H,6H2/t8-,10-,11-/m1/s1 |
| InChIKey | GSDCVJNJGLWAJO-FBIMIBRVSA-N |
| XLogP | -0.48 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |