C16H13NO4S — CID 14610963
3-(benzenesulfonyl)-1-phenylpyrrolidine-2,5-dione (PubChem CID 14610963) has the molecular formula C16H13NO4S and a molecular weight of 315.35 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-1-phenylpyrrolidine-2,5-dione.
| Compound Name | 3-(benzenesulfonyl)-1-phenylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 14610963 |
| Molecular Formula | C16H13NO4S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 3-(benzenesulfonyl)-1-phenylpyrrolidine-2,5-dione |
| SMILES | O=C1CC(S(=O)(=O)c2ccccc2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C16H13NO4S/c18-15-11-14(22(20,21)13-9-5-2-6-10-13)16(19)17(15)12-7-3-1-4-8-12/h1-10,14H,11H2 |
| InChIKey | PPMKHMWTZSQMRV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|