C16H19NO4S — CID 13291999
3-cyclopentylsulfonyl-1-(4-methylphenyl)pyrrolidine-2,5-dione (PubChem CID 13291999) has the molecular formula C16H19NO4S and a molecular weight of 321.40 g/mol. Its IUPAC name is 3-cyclopentylsulfonyl-1-(4-methylphenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-cyclopentylsulfonyl-1-(4-methylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 13291999 |
| Molecular Formula | C16H19NO4S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 3-cyclopentylsulfonyl-1-(4-methylphenyl)pyrrolidine-2,5-dione |
| SMILES | Cc1ccc(N2C(=O)CC(S(=O)(=O)C3CCCC3)C2=O)cc1 |
| InChI | InChI=1S/C16H19NO4S/c1-11-6-8-12(9-7-11)17-15(18)10-14(16(17)19)22(20,21)13-4-2-3-5-13/h6-9,13-14H,2-5,10H2,1H3 |
| InChIKey | ROPDHOFDWRERBT-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|