C14H14O2S — CID 100975034
(1R,4S,5S)-5-(benzenesulfonyl)-6-methylidenebicyclo[2.2.1]hept-2-ene (PubChem CID 100975034) has the molecular formula C14H14O2S and a molecular weight of 246.33 g/mol. Its IUPAC name is (1R,4S,5S)-5-(benzenesulfonyl)-6-methylidenebicyclo[2.2.1]hept-2-ene.
| Compound Name | (1R,4S,5S)-5-(benzenesulfonyl)-6-methylidenebicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 100975034 |
| Molecular Formula | C14H14O2S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | (1R,4S,5S)-5-(benzenesulfonyl)-6-methylidenebicyclo[2.2.1]hept-2-ene |
| SMILES | C=C1[C@@H](S(=O)(=O)c2ccccc2)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C14H14O2S/c1-10-11-7-8-12(9-11)14(10)17(15,16)13-5-3-2-4-6-13/h2-8,11-12,14H,1,9H2/t11-,12+,14+/m0/s1 |
| InChIKey | GMAZXQBTPSRDSN-OUCADQQQSA-N |
| XLogP | 2.59 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|