C13H14O3S — CID 131863859
(1S,6S)-6-(benzenesulfonyl)-5-methylidenecyclohex-2-en-1-ol (PubChem CID 131863859) has the molecular formula C13H14O3S and a molecular weight of 250.32 g/mol. Its IUPAC name is (1S,6S)-6-(benzenesulfonyl)-5-methylidenecyclohex-2-en-1-ol.
| Compound Name | (1S,6S)-6-(benzenesulfonyl)-5-methylidenecyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 131863859 |
| Molecular Formula | C13H14O3S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | (1S,6S)-6-(benzenesulfonyl)-5-methylidenecyclohex-2-en-1-ol |
| SMILES | C=C1CC=C[C@H](O)[C@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H14O3S/c1-10-6-5-9-12(14)13(10)17(15,16)11-7-3-2-4-8-11/h2-5,7-9,12-14H,1,6H2/t12-,13-/m0/s1 |
| InChIKey | AZDPAHIOHGLPJF-STQMWFEESA-N |
| XLogP | 1.71 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|