C14H16O2S — CID 100975041
(1S,2S,4R)-2-(benzenesulfonyl)-2-deuterio-3-methylidenebicyclo[2.2.1]heptane (PubChem CID 100975041) has the molecular formula C14H16O2S and a molecular weight of 249.35 g/mol. Its IUPAC name is (1S,2S,4R)-2-(benzenesulfonyl)-2-deuterio-3-methylidenebicyclo[2.2.1]heptane.
| Compound Name | (1S,2S,4R)-2-(benzenesulfonyl)-2-deuterio-3-methylidenebicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 100975041 |
| Molecular Formula | C14H16O2S |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | (1S,2S,4R)-2-(benzenesulfonyl)-2-deuterio-3-methylidenebicyclo[2.2.1]heptane |
| SMILES | [2H][C@@]1(S(=O)(=O)c2ccccc2)C(=C)[C@@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C14H16O2S/c1-10-11-7-8-12(9-11)14(10)17(15,16)13-5-3-2-4-6-13/h2-6,11-12,14H,1,7-9H2/t11-,12+,14-/m1/s1/i14D |
| InChIKey | UPDZLYKLVVOLAM-XYNFAVSOSA-N |
| XLogP | 2.82 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|