C19H22O6S — CID 14764369
methyl (4aS,5R,8aR)-8-(benzenesulfonyl)-5-methyl-4,7-dioxo-2,3,5,6,8,8a-hexahydro-1H-naphthalene-4a-carboxylate (PubChem CID 14764369) has the molecular formula C19H22O6S and a molecular weight of 378.45 g/mol. Its IUPAC name is methyl (4aS,5R,8aR)-8-(benzenesulfonyl)-5-methyl-4,7-dioxo-2,3,5,6,8,8a-hexahydro-1H-naphthalene-4a-carboxylate.
| Compound Name | methyl (4aS,5R,8aR)-8-(benzenesulfonyl)-5-methyl-4,7-dioxo-2,3,5,6,8,8a-hexahydro-1H-naphthalene-4a-carboxylate |
|---|---|
| PubChem CID | 14764369 |
| Molecular Formula | C19H22O6S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | methyl (4aS,5R,8aR)-8-(benzenesulfonyl)-5-methyl-4,7-dioxo-2,3,5,6,8,8a-hexahydro-1H-naphthalene-4a-carboxylate |
| SMILES | COC(=O)[C@]12C(=O)CCC[C@H]1C(S(=O)(=O)c1ccccc1)C(=O)C[C@H]2C |
| InChI | InChI=1S/C19H22O6S/c1-12-11-15(20)17(26(23,24)13-7-4-3-5-8-13)14-9-6-10-16(21)19(12,14)18(22)25-2/h3-5,7-8,12,14,17H,6,9-11H2,1-2H3/t12-,14+,17?,19+/m1/s1 |
| InChIKey | HQFMVRABXJPQKH-JPZBGEEZSA-N |
| XLogP | 1.97 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|