C19H22O3 — CID 101473342
methyl (4aS,7R,8aR)-7-methyl-4-oxo-7-phenyl-2,3,8,8a-tetrahydro-1H-naphthalene-4a-carboxylate (PubChem CID 101473342) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is methyl (4aS,7R,8aR)-7-methyl-4-oxo-7-phenyl-2,3,8,8a-tetrahydro-1H-naphthalene-4a-carboxylate.
| Compound Name | methyl (4aS,7R,8aR)-7-methyl-4-oxo-7-phenyl-2,3,8,8a-tetrahydro-1H-naphthalene-4a-carboxylate |
|---|---|
| PubChem CID | 101473342 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | methyl (4aS,7R,8aR)-7-methyl-4-oxo-7-phenyl-2,3,8,8a-tetrahydro-1H-naphthalene-4a-carboxylate |
| SMILES | COC(=O)[C@]12C=C[C@](C)(c3ccccc3)C[C@H]1CCCC2=O |
| InChI | InChI=1S/C19H22O3/c1-18(14-7-4-3-5-8-14)11-12-19(17(21)22-2)15(13-18)9-6-10-16(19)20/h3-5,7-8,11-12,15H,6,9-10,13H2,1-2H3/t15-,18+,19-/m1/s1 |
| InChIKey | JOJJHJRZKLTDHK-AYOQOUSVSA-N |
| XLogP | 3.43 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|