C15H18O4S — CID 11323866
methyl 3-(benzenesulfonyl)-2-methylcyclohexene-1-carboxylate (PubChem CID 11323866) has the molecular formula C15H18O4S and a molecular weight of 294.37 g/mol. Its IUPAC name is methyl 3-(benzenesulfonyl)-2-methylcyclohexene-1-carboxylate.
| Compound Name | methyl 3-(benzenesulfonyl)-2-methylcyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 11323866 |
| Molecular Formula | C15H18O4S |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | methyl 3-(benzenesulfonyl)-2-methylcyclohexene-1-carboxylate |
| SMILES | COC(=O)C1=C(C)C(S(=O)(=O)c2ccccc2)CCC1 |
| InChI | InChI=1S/C15H18O4S/c1-11-13(15(16)19-2)9-6-10-14(11)20(17,18)12-7-4-3-5-8-12/h3-5,7-8,14H,6,9-10H2,1-2H3 |
| InChIKey | SZIJBYRHDWQINZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |