C16H20O4S — CID 22026135
ethyl 6-benzylsulfonylcyclohexene-1-carboxylate (PubChem CID 22026135) has the molecular formula C16H20O4S and a molecular weight of 308.40 g/mol. Its IUPAC name is ethyl 6-benzylsulfonylcyclohexene-1-carboxylate.
| Compound Name | ethyl 6-benzylsulfonylcyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 22026135 |
| Molecular Formula | C16H20O4S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | ethyl 6-benzylsulfonylcyclohexene-1-carboxylate |
| SMILES | CCOC(=O)C1=CCCCC1S(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C16H20O4S/c1-2-20-16(17)14-10-6-7-11-15(14)21(18,19)12-13-8-4-3-5-9-13/h3-5,8-10,15H,2,6-7,11-12H2,1H3 |
| InChIKey | POYBMJBHEKRYOT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |