C16H19ClO4S — CID 44567327
ethyl 6-[(4-chlorophenyl)methylsulfonyl]cyclohexene-1-carboxylate (PubChem CID 44567327) has the molecular formula C16H19ClO4S and a molecular weight of 342.84 g/mol. Its IUPAC name is ethyl 6-[(4-chlorophenyl)methylsulfonyl]cyclohexene-1-carboxylate.
| Compound Name | ethyl 6-[(4-chlorophenyl)methylsulfonyl]cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 44567327 |
| Molecular Formula | C16H19ClO4S |
| Molecular Weight | 342.84 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | ethyl 6-[(4-chlorophenyl)methylsulfonyl]cyclohexene-1-carboxylate |
| SMILES | CCOC(=O)C1=CCCCC1S(=O)(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H19ClO4S/c1-2-21-16(18)14-5-3-4-6-15(14)22(19,20)11-12-7-9-13(17)10-8-12/h5,7-10,15H,2-4,6,11H2,1H3 |
| InChIKey | WWJOSECNQVXHLI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.84 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |