C16H19FO4S — CID 44567325
ethyl 6-[(2-fluorophenyl)methylsulfonyl]cyclohexene-1-carboxylate (PubChem CID 44567325) has the molecular formula C16H19FO4S and a molecular weight of 326.39 g/mol. Its IUPAC name is ethyl 6-[(2-fluorophenyl)methylsulfonyl]cyclohexene-1-carboxylate.
| Compound Name | ethyl 6-[(2-fluorophenyl)methylsulfonyl]cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 44567325 |
| Molecular Formula | C16H19FO4S |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | ethyl 6-[(2-fluorophenyl)methylsulfonyl]cyclohexene-1-carboxylate |
| SMILES | CCOC(=O)C1=CCCCC1S(=O)(=O)Cc1ccccc1F |
| InChI | InChI=1S/C16H19FO4S/c1-2-21-16(18)13-8-4-6-10-15(13)22(19,20)11-12-7-3-5-9-14(12)17/h3,5,7-9,15H,2,4,6,10-11H2,1H3 |
| InChIKey | DMBWXEYLFQLXDP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |