C16H18ClFO4S — CID 44567324
ethyl 6-[(4-chloro-2-fluorophenyl)methylsulfonyl]cyclohexene-1-carboxylate (PubChem CID 44567324) has the molecular formula C16H18ClFO4S and a molecular weight of 360.83 g/mol. Its IUPAC name is ethyl 6-[(4-chloro-2-fluorophenyl)methylsulfonyl]cyclohexene-1-carboxylate.
| Compound Name | ethyl 6-[(4-chloro-2-fluorophenyl)methylsulfonyl]cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 44567324 |
| Molecular Formula | C16H18ClFO4S |
| Molecular Weight | 360.83 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | ethyl 6-[(4-chloro-2-fluorophenyl)methylsulfonyl]cyclohexene-1-carboxylate |
| SMILES | CCOC(=O)C1=CCCCC1S(=O)(=O)Cc1ccc(Cl)cc1F |
| InChI | InChI=1S/C16H18ClFO4S/c1-2-22-16(19)13-5-3-4-6-15(13)23(20,21)10-11-7-8-12(17)9-14(11)18/h5,7-9,15H,2-4,6,10H2,1H3 |
| InChIKey | YNUBGNHYXUNQPQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.83 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |