C17H20ClFO4S — CID 25113737
ethyl (6R)-6-[(1S)-1-(2-chloro-4-fluorophenyl)ethyl]sulfonylcyclohexene-1-carboxylate (PubChem CID 25113737) has the molecular formula C17H20ClFO4S and a molecular weight of 374.86 g/mol. Its IUPAC name is ethyl (6R)-6-[(1S)-1-(2-chloro-4-fluorophenyl)ethyl]sulfonylcyclohexene-1-carboxylate.
| Compound Name | ethyl (6R)-6-[(1S)-1-(2-chloro-4-fluorophenyl)ethyl]sulfonylcyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 25113737 |
| Molecular Formula | C17H20ClFO4S |
| Molecular Weight | 374.86 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | ethyl (6R)-6-[(1S)-1-(2-chloro-4-fluorophenyl)ethyl]sulfonylcyclohexene-1-carboxylate |
| SMILES | CCOC(=O)C1=CCCC[C@H]1S(=O)(=O)[C@@H](C)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C17H20ClFO4S/c1-3-23-17(20)14-6-4-5-7-16(14)24(21,22)11(2)13-9-8-12(19)10-15(13)18/h6,8-11,16H,3-5,7H2,1-2H3/t11-,16+/m0/s1 |
| InChIKey | LGURHLFOVULKNO-MEDUHNTESA-N |
| XLogP | 4.00 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.86 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |