C20H33NO4SSi — CID 101160395
(3S,4R)-3-(benzenesulfonyl)-1-butyl-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-one (PubChem CID 101160395) has the molecular formula C20H33NO4SSi and a molecular weight of 411.64 g/mol. Its IUPAC name is (3S,4R)-3-(benzenesulfonyl)-1-butyl-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-one.
| Compound Name | (3S,4R)-3-(benzenesulfonyl)-1-butyl-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-one |
|---|---|
| PubChem CID | 101160395 |
| Molecular Formula | C20H33NO4SSi |
| Molecular Weight | 411.64 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | (3S,4R)-3-(benzenesulfonyl)-1-butyl-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-one |
| SMILES | CCCCN1C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](S(=O)(=O)c2ccccc2)C1=O |
| InChI | InChI=1S/C20H33NO4SSi/c1-7-8-14-21-15-17(25-27(5,6)20(2,3)4)18(19(21)22)26(23,24)16-12-10-9-11-13-16/h9-13,17-18H,7-8,14-15H2,1-6H3/t17-,18+/m1/s1 |
| InChIKey | YTUACOLGTPQJIR-MSOLQXFVSA-N |
| XLogP | 3.86 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.64 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|