C21H35NO3Si — CID 101212293
(3S)-1-benzyl-5-butyl-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxypyrrolidin-2-one (PubChem CID 101212293) has the molecular formula C21H35NO3Si and a molecular weight of 377.60 g/mol. Its IUPAC name is (3S)-1-benzyl-5-butyl-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxypyrrolidin-2-one.
| Compound Name | (3S)-1-benzyl-5-butyl-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxypyrrolidin-2-one |
|---|---|
| PubChem CID | 101212293 |
| Molecular Formula | C21H35NO3Si |
| Molecular Weight | 377.60 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | (3S)-1-benzyl-5-butyl-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxypyrrolidin-2-one |
| SMILES | CCCCC1(O)C[C@H](O[Si](C)(C)C(C)(C)C)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C21H35NO3Si/c1-7-8-14-21(24)15-18(25-26(5,6)20(2,3)4)19(23)22(21)16-17-12-10-9-11-13-17/h9-13,18,24H,7-8,14-16H2,1-6H3/t18-,21?/m0/s1 |
| InChIKey | GGKXGQVZBHNCRE-YMXDCFFPSA-N |
| XLogP | 4.69 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.60 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|